| Primary information |
|---|
| PRRID | PRRID_0852 |
| Ligand Name | β -1,3-glucan |
| Source | Fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glucan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | PGRP-S2 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Chlamys farreri |
| Localization | mantle, gill, kidney and gonad |
| Domain | NA |
| Sequence of Receptor | Q9VYX7.fasta |
| Swiss prot ID | Q9VYX7 |
| Length Of Receptor | 203 |
| Function | It has the role in the inflammation. |
| Assay used | NA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0852 |
| Ligand Name | β -1,3-glucan |
| Source | Fungi |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Glucan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | PGRP-S2 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Chlamys farreri |
| Localization | mantle, gill, kidney and gonad |
| Domain | NA |
| Sequence of Receptor | Q9VYX7.fasta |
| Swiss prot ID | Q9VYX7 |
| Length Of Receptor | 203 |
| Function | It has the role in the inflammation. |
| Assay used | NA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |