| Primary information |
|---|
| PRRID | PRRID_0782 |
| Ligand Name | Resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | The binding results into the robust TNF-‚ç∫ and IL-12 production |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | APCs |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 20636030 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0782 |
| Ligand Name | Resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | The binding results into the robust TNF-‚ç∫ and IL-12 production |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | APCs |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 20636030 |
| Year of Publication | 2010 |
| Pubchem assay | NA |