| Primary information |
|---|
| PRRID | PRRID_0772 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Cells infected with viruses triggering MDA5-dependent IFN induction |
| Name of receptor | RIG-1 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | IFN triggers the expression of antiviral proteins, promote the destruction of infected cells by natural killer cells, and facilitate the production of neutralizing antibodies and cytotoxic T-cell responses. |
| Assay used | NA |
| PMID | 20354786 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0772 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Cells infected with viruses triggering MDA5-dependent IFN induction |
| Name of receptor | RIG-1 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | IFN triggers the expression of antiviral proteins, promote the destruction of infected cells by natural killer cells, and facilitate the production of neutralizing antibodies and cytotoxic T-cell responses. |
| Assay used | NA |
| PMID | 20354786 |
| Year of Publication | 2010 |
| Pubchem assay | NA |