Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0767 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0767 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It's binding activate type I IFN response |
| Name of receptor | MDA5 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It results into the anti-viral response by the immune system of host |
| Assay used | NA |
| PMID | 20620129 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information | |
|---|---|
| PRRID | PRRID_0767 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It's binding activate type I IFN response |
| Name of receptor | MDA5 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It results into the anti-viral response by the immune system of host |
| Assay used | NA |
| PMID | 20620129 |
| Year of Publication | 2010 |
| Pubchem assay | NA |