| Primary information |
|---|
| PRRID | PRRID_0761 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It results into the induction of type I IFNs |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chicken |
| Localization | Spleenocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | D6R3C9.fasta |
| Swiss prot ID | D6R3C9 |
| Length Of Receptor | 66 |
| Function | Immunostimulation |
| Assay used | NA |
| PMID | 20692289 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0761 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It results into the induction of type I IFNs |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Chicken |
| Localization | Spleenocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | D6R3C9.fasta |
| Swiss prot ID | D6R3C9 |
| Length Of Receptor | 66 |
| Function | Immunostimulation |
| Assay used | NA |
| PMID | 20692289 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |