| Primary information |
|---|
| PRRID | PRRID_0743 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Vibrio anguillarum and Micrococcus lysodeikticus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | PGRP-S1 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Chlamys farreri |
| Localization | mantle, gill, kidney and gonad |
| Domain | NA |
| Sequence of Receptor | Q9VYX7.fasta |
| Swiss prot ID | Q9VYX7 |
| Length Of Receptor | 203 |
| Function | It leads to the degradation of PGN, induction of phagocytosis and activation of prophenoloxidase (proPO) system |
| Assay used | ELISA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0743 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Vibrio anguillarum and Micrococcus lysodeikticus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | PGRP-S1 |
| Type of receptor | Peptidoglycan Recognition Receptor (PGRPs) |
| Source | Chlamys farreri |
| Localization | mantle, gill, kidney and gonad |
| Domain | NA |
| Sequence of Receptor | Q9VYX7.fasta |
| Swiss prot ID | Q9VYX7 |
| Length Of Receptor | 203 |
| Function | It leads to the degradation of PGN, induction of phagocytosis and activation of prophenoloxidase (proPO) system |
| Assay used | ELISA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |