| Primary information |
|---|
| PRRID | PRRID_0732 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Microglia |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | It boosted the ingestion of Alzheimer’s disease neurotoxic Amyloid β (Aβ) protein in vitro |
| Assay used | NA |
| PMID | 20706642 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0732 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Microglia |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | It boosted the ingestion of Alzheimer’s disease neurotoxic Amyloid β (Aβ) protein in vitro |
| Assay used | NA |
| PMID | 20706642 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |