| Primary information |
|---|
| PRRID | PRRID_0730 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Peptidoglycan is the potent activator of the TLR2 |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | stage 3-4 CKD and HD patients |
| Localization | CD14+ Monocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It has the role in the inflammation. |
| Assay used | NA |
| PMID | 20729266 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0730 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | Gram-positive bacteria |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Peptidoglycan is the potent activator of the TLR2 |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | stage 3-4 CKD and HD patients |
| Localization | CD14+ Monocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It has the role in the inflammation. |
| Assay used | NA |
| PMID | 20729266 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |