| Primary information |
|---|
| PRRID | PRRID_0720 |
| Ligand Name | Paclitaxel |
| Source | NA |
| Sequence of ligand | C1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| Length | NA |
| Type | Drug |
| Occurence | Synthetic |
| Role of Ligand | It hasthe role in the activation of the adapter protein MyD88 was linked to reduction of apoptosis in cancer cells. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human(Ovarian Cancer Patient) |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | NA |
| Assay used | NA |
| PMID | 20728343 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0720 |
| Ligand Name | Paclitaxel |
| Source | NA |
| Sequence of ligand | C1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| Length | NA |
| Type | Drug |
| Occurence | Synthetic |
| Role of Ligand | It hasthe role in the activation of the adapter protein MyD88 was linked to reduction of apoptosis in cancer cells. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human(Ovarian Cancer Patient) |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | NA |
| Assay used | NA |
| PMID | 20728343 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |