| Primary information |
|---|
| PRRID | PRRID_0706 |
| Ligand Name | naked dsRNS (poly(I:C)) |
| Source | Bacteria |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | induced a reduction in maximal mitochondrial respiration |
| Name of receptor | Toll-like receptor 3,7,9 (TLR3/7/9) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Human hepatocytes (HepG2 cells) |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | This resultsinto mitochondrial dysfunction which is accompanied by caspase-8 |
| Assay used | NA |
| PMID | 20691286 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0706 |
| Ligand Name | naked dsRNS (poly(I:C)) |
| Source | Bacteria |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | induced a reduction in maximal mitochondrial respiration |
| Name of receptor | Toll-like receptor 3,7,9 (TLR3/7/9) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Human hepatocytes (HepG2 cells) |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | This resultsinto mitochondrial dysfunction which is accompanied by caspase-8 |
| Assay used | NA |
| PMID | 20691286 |
| Year of Publication | 2010 |
| Pubchem assay | NA |