| Primary information |
|---|
| PRRID | PRRID_0694 |
| Ligand Name | muramyl dipeptide (MDP) + LPS + Poly(I:C) |
| Source | Bacteria |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | It help in NF |
| Name of receptor | Nod-like receptor C4 (NLRC4) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | C57BL/6 Mice |
| Localization | liver and Hepatocytes |
| Domain | NA |
| Sequence of Receptor | Q3UP24.fasta |
| Swiss prot ID | Q3UP24 |
| Length Of Receptor | 1024 |
| Function | It plays an important regulatory role in many inflammatory processes involving the liver. |
| Assay used | Immunoblotting and EMSA |
| PMID | 20615568 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0694 |
| Ligand Name | muramyl dipeptide (MDP) + LPS + Poly(I:C) |
| Source | Bacteria |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | It help in NF |
| Name of receptor | Nod-like receptor C4 (NLRC4) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | C57BL/6 Mice |
| Localization | liver and Hepatocytes |
| Domain | NA |
| Sequence of Receptor | Q3UP24.fasta |
| Swiss prot ID | Q3UP24 |
| Length Of Receptor | 1024 |
| Function | It plays an important regulatory role in many inflammatory processes involving the liver. |
| Assay used | Immunoblotting and EMSA |
| PMID | 20615568 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |