| Primary information |
|---|
| PRRID | PRRID_0682 |
| Ligand Name | mmLDL |
| Source | Native Human LDL (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Synthetic |
| Role of Ligand | The binding of mmLDL, induces the production of TNF-and increasing the expression of TLR2 and TLR5 |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Monocytes and Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It triggering an inflammatory response characterized by induction of TNF-‚ç∫ production and upregulation of TLR2 and TLR4 expression in human monocytes and macrophages. |
| Assay used | ELISA |
| PMID | 20472010 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0682 |
| Ligand Name | mmLDL |
| Source | Native Human LDL (others) |
| Sequence of ligand | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Synthetic |
| Role of Ligand | The binding of mmLDL, induces the production of TNF-and increasing the expression of TLR2 and TLR5 |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Monocytes and Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It triggering an inflammatory response characterized by induction of TNF-‚ç∫ production and upregulation of TLR2 and TLR4 expression in human monocytes and macrophages. |
| Assay used | ELISA |
| PMID | 20472010 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |