| Primary information |
|---|
| PRRID | PRRID_0679 |
| Ligand Name | mesodiaminopimelic acid |
| Source | Bacteria |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | upon ligand sensing, oligomerize and recruit RIP2 via CARD-CARD interactions |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It culminates in the activation of the NF-kB transcription factor, which drives proinflammatory gene regulation |
| Assay used | NA |
| PMID | 20303873 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0679 |
| Ligand Name | mesodiaminopimelic acid |
| Source | Bacteria |
| Sequence of ligand | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Length | NA |
| Type | Peptide |
| Occurence | Natural |
| Role of Ligand | upon ligand sensing, oligomerize and recruit RIP2 via CARD-CARD interactions |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | NA |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It culminates in the activation of the NF-kB transcription factor, which drives proinflammatory gene regulation |
| Assay used | NA |
| PMID | 20303873 |
| Year of Publication | 2010 |
| Pubchem assay | NA |