| Primary information |
|---|
| PRRID | PRRID_0663 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | NA |
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It led to the activation of NF-κB and upregulate the expression of the antiapoptotic protein Bcl-2. |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Lung cancer cells |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | This resulted into increased tumor cell survival and resistance to apoptosis induced by chemotherapy. |
| Assay used | ELISA |
| PMID | 20237413 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0663 |
| Ligand Name | Loxoribine (7-allyl-7,8-dihydro-8-oxo-guanosine) |
| Source | NA |
| Sequence of ligand | C=CCN1C2=C(NC(=NC2=O)N)N(C1=O)C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It led to the activation of NF-κB and upregulate the expression of the antiapoptotic protein Bcl-2. |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Lung cancer cells |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | This resulted into increased tumor cell survival and resistance to apoptosis induced by chemotherapy. |
| Assay used | ELISA |
| PMID | 20237413 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |