| Primary information |
|---|
| PRRID | PRRID_0655 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Toll-like receptor 2 Arg753Gln (TLR-2 Arg753Gln) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | FMF patients |
| Localization | monocytes and granulocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Upregulate inflammation in FMF patients |
| Assay used | NA |
| PMID | 20714796 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0655 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Toll-like receptor 2 Arg753Gln (TLR-2 Arg753Gln) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | FMF patients |
| Localization | monocytes and granulocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Upregulate inflammation in FMF patients |
| Assay used | NA |
| PMID | 20714796 |
| Year of Publication | 2010 |
| Pubchem assay | NA |