| Primary information |
|---|
| PRRID | PRRID_0654 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Lactobacillus acidophilus, Prevotella melaninogenica, P. bivia and Mycobacterium smegmatis (Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Enhanced HIV-1 expression in macrophages |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It leads to the clearance of the pathogen from the system |
| Assay used | NA |
| PMID | 20719993 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0654 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Lactobacillus acidophilus, Prevotella melaninogenica, P. bivia and Mycobacterium smegmatis (Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Enhanced HIV-1 expression in macrophages |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It leads to the clearance of the pathogen from the system |
| Assay used | NA |
| PMID | 20719993 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |