| Primary information |
|---|
| PRRID | PRRID_0650 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Their binding to the TLR2 leads to the activation of the downstream signalling |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57/BL Mice cell line |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O53505.fasta |
| Swiss prot ID | O53505 |
| Length Of Receptor | 227 |
| Function | maturation of the Dendritic cells |
| Assay used | NA |
| PMID | 20795386 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0650 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | Their binding to the TLR2 leads to the activation of the downstream signalling |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | C57/BL Mice cell line |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O53505.fasta |
| Swiss prot ID | O53505 |
| Length Of Receptor | 227 |
| Function | maturation of the Dendritic cells |
| Assay used | NA |
| PMID | 20795386 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |