| Primary information |
|---|
| PRRID | PRRID_0579 |
| Ligand Name | imiquimod (R-837) and resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It produce pro-inflammatory cytokines including IFNα, TNFα and/or IL-12 |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | DCs, monocytes, macrophages, lymphocytes, Langerhans cells, and NK cells |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | Itresults into the inflammatory response |
| Assay used | NA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0579 |
| Ligand Name | imiquimod (R-837) and resiquimod (R-848) |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It produce pro-inflammatory cytokines including IFNα, TNFα and/or IL-12 |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | DCs, monocytes, macrophages, lymphocytes, Langerhans cells, and NK cells |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9NR97.fasta |
| Swiss prot ID | Q9NR97 |
| Length Of Receptor | 1041 |
| Function | Itresults into the inflammatory response |
| Assay used | NA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |