| Primary information |
|---|
| PRRID | PRRID_0575 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces translocation of NF-kB and production of IFN-α, TNF-α, IL-6, and IL-12 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Cyprinus carpio L |
| Localization | head kidney |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has the role in the inflammation. |
| Assay used | NA |
| PMID | 20709611 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0575 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces translocation of NF-kB and production of IFN-α, TNF-α, IL-6, and IL-12 |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Cyprinus carpio L |
| Localization | head kidney |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has the role in the inflammation. |
| Assay used | NA |
| PMID | 20709611 |
| Year of Publication | 2010 |
| Pubchem assay | NA |