| Primary information |
|---|
| PRRID | PRRID_0574 |
| Ligand Name | Imiquimod |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces inflammatory responses when applied to the skin |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | It leads to the inflammation of the cell |
| Assay used | NA |
| PMID | 20739947 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0574 |
| Ligand Name | Imiquimod |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It induces inflammatory responses when applied to the skin |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | P58681.fasta |
| Swiss prot ID | P58681 |
| Length Of Receptor | 1050 |
| Function | It leads to the inflammation of the cell |
| Assay used | NA |
| PMID | 20739947 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |