| Primary information |
|---|
| PRRID | PRRID_0570 |
| Ligand Name | Hyaluronic acid |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | Interaction between lower molecular weight HA and TLR leads to decrease in CD44-dependent clearance of HA leads to enhanced lung inflammation and injury |
| Name of receptor | Toll-like receptor 2 (TLR2)/Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Macropahges |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the production of inflammatory chemokines and cytokines |
| Assay used | NA |
| PMID | 20689929 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0570 |
| Ligand Name | Hyaluronic acid |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | Interaction between lower molecular weight HA and TLR leads to decrease in CD44-dependent clearance of HA leads to enhanced lung inflammation and injury |
| Name of receptor | Toll-like receptor 2 (TLR2)/Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Macropahges |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the production of inflammatory chemokines and cytokines |
| Assay used | NA |
| PMID | 20689929 |
| Year of Publication | 2010 |
| Pubchem assay | NA |