| Primary information |
|---|
| PRRID | PRRID_0553 |
| Ligand Name | Heme |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1=C(C2=CC3=C(C(=C([N-]3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1[N-]2)C=C)C)C=C)C)C)CCC(=O)O)CCC(=O)O |
| Length | NA |
| Type | Endogenous |
| Occurence | Natural |
| Role of Ligand | Binding of Heme to TLR4 leads to increased production of the proinflammatory cytokine, tumor necrosis factor-alpha |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | Macropahges |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 20689929 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0553 |
| Ligand Name | Heme |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC1=C(C2=CC3=C(C(=C([N-]3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1[N-]2)C=C)C)C=C)C)C)CCC(=O)O)CCC(=O)O |
| Length | NA |
| Type | Endogenous |
| Occurence | Natural |
| Role of Ligand | Binding of Heme to TLR4 leads to increased production of the proinflammatory cytokine, tumor necrosis factor-alpha |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | NA |
| Localization | Macropahges |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | NA |
| PMID | 20689929 |
| Year of Publication | 2010 |
| Pubchem assay | NA |