| Primary information |
|---|
| PRRID | PRRID_0544 |
| Ligand Name | HA |
| Source | Measles virus (virus) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | Activate NF-κB |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | Induce cytokine production such as such as IL-1α, IL-1β, IL-6, IL-8 and IL-12 |
| Assay used | NA |
| PMID | 20672047 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0544 |
| Ligand Name | HA |
| Source | Measles virus (virus) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Protein |
| Occurence | Natural |
| Role of Ligand | Activate NF-κB |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | NA |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | Induce cytokine production such as such as IL-1α, IL-1β, IL-6, IL-8 and IL-12 |
| Assay used | NA |
| PMID | 20672047 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |