| Primary information |
|---|
| PRRID | PRRID_0536 |
| Ligand Name | Glycoinositol phospholipids |
| Source | Trypanosoma (others) |
| Sequence of ligand | C(C(COP(=O)(O)OC1C(C(C(C(C1O)O)O)O)O)OC=O)OC=O |
| Length | NA |
| Type | Lipid |
| Occurence | Natural |
| Role of Ligand | Upon recogniton by the TLR, it induces induces the recruitment of adaptor proteins MyD88,TIRAP, TRAM and TRIF |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Cell surface |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | It leadsto the secretion of the proinfalmmatory cytokines and IFN-β |
| Assay used | NA |
| PMID | 20620129 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0536 |
| Ligand Name | Glycoinositol phospholipids |
| Source | Trypanosoma (others) |
| Sequence of ligand | C(C(COP(=O)(O)OC1C(C(C(C(C1O)O)O)O)O)OC=O)OC=O |
| Length | NA |
| Type | Lipid |
| Occurence | Natural |
| Role of Ligand | Upon recogniton by the TLR, it induces induces the recruitment of adaptor proteins MyD88,TIRAP, TRAM and TRIF |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Cell surface |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | O00206.fasta |
| Swiss prot ID | O00206 |
| Length Of Receptor | 839 |
| Function | It leadsto the secretion of the proinfalmmatory cytokines and IFN-β |
| Assay used | NA |
| PMID | 20620129 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |