Detailed description page of PRRDB2.0
| This page displays user query in tabular form. |
PRRID_0535 details |
| Primary information | |
|---|---|
| PRRID | PRRID_0535 |
| Ligand Name | Glycoinositol phospholipids |
| Source | Trypanosoma (others) |
| Sequence of ligand | C(C(COP(=O)(O)OC1C(C(C(C(C1O)O)O)O)O)OC=O)OC=O |
| Length | NA |
| Type | Lipid |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | dendritic cells and macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | NA |
| Assay used | NA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information | |
|---|---|
| PRRID | PRRID_0535 |
| Ligand Name | Glycoinositol phospholipids |
| Source | Trypanosoma (others) |
| Sequence of ligand | C(C(COP(=O)(O)OC1C(C(C(C(C1O)O)O)O)O)OC=O)OC=O |
| Length | NA |
| Type | Lipid |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | dendritic cells and macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | NA |
| Assay used | NA |
| PMID | 20713100 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |