| Primary information |
|---|
| PRRID | PRRID_0529 |
| Ligand Name | Gardiquimod |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCNCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It activates the NF- |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Spleenocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | It leads to the activation of splenocytes and the inhibition of murine B16 melanoma growth and metastasis |
| Assay used | NA |
| PMID | 20543857 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0529 |
| Ligand Name | Gardiquimod |
| Source | imidazoquinoline (others) |
| Sequence of ligand | CCNCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It activates the NF- |
| Name of receptor | Toll-like receptor 8 (TLR8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Spleenocytes |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | P58682.fasta |
| Swiss prot ID | P58682 |
| Length Of Receptor | 1032 |
| Function | It leads to the activation of splenocytes and the inhibition of murine B16 melanoma growth and metastasis |
| Assay used | NA |
| PMID | 20543857 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |