| Primary information |
|---|
| PRRID | PRRID_0464 |
| Ligand Name | diaminopimelic acid (C12-iEDAP) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Muropeptide |
| Occurence | Natural |
| Role of Ligand | It's binding to NOD1 induce NFκB activation, activation of MAP kinases and expression of chemokines CCL5 (RANTES) and CXCL1 (KC) and of nitric oxide |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | C57BL/6 Mice |
| Localization | liver and Hepatocytes |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | It helps in attracting leukocytes to the liver during infection and for hepatic NLRs to augment innate immune responses to pathogens. |
| Assay used | Immunoblotting and EMSA |
| PMID | 20615568 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0464 |
| Ligand Name | diaminopimelic acid (C12-iEDAP) |
| Source | Gram-negative and Gram-positive bacteria |
| Sequence of ligand | N[C@@H](CCC[C@@H](NC(=O)CC[C@@H](N)C(O)=O)C(O)=O)C(O)=O |
| Length | NA |
| Type | Muropeptide |
| Occurence | Natural |
| Role of Ligand | It's binding to NOD1 induce NFκB activation, activation of MAP kinases and expression of chemokines CCL5 (RANTES) and CXCL1 (KC) and of nitric oxide |
| Name of receptor | Nucleotide Binding Oligomerization Domain Containing 1 (Nod1) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | C57BL/6 Mice |
| Localization | liver and Hepatocytes |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | It helps in attracting leukocytes to the liver during infection and for hepatic NLRs to augment innate immune responses to pathogens. |
| Assay used | Immunoblotting and EMSA |
| PMID | 20615568 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |