| Primary information |
|---|
| PRRID | PRRID_0461 |
| Ligand Name | Dextran |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC(C(C(C(C=O)O)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It is the responsive PAMP for the FcLec5 |
| Name of receptor | FcLec5 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Fenneropenaeus chinensis |
| Localization | hepatopancreas |
| Domain | CRD |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It elicit the immune response, which leads to the clearance of bacteria |
| Assay used | ELISA |
| PMID | 20349323 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0461 |
| Ligand Name | Dextran |
| Source | Bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC(C(C(C(C=O)O)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It is the responsive PAMP for the FcLec5 |
| Name of receptor | FcLec5 |
| Type of receptor | C type Lectin (CTL/CLR) |
| Source | Fenneropenaeus chinensis |
| Localization | hepatopancreas |
| Domain | CRD |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It elicit the immune response, which leads to the clearance of bacteria |
| Assay used | ELISA |
| PMID | 20349323 |
| Year of Publication | 2010 |
| Pubchem assay | NA |