| Primary information |
|---|
| PRRID | PRRID_0435 |
| Ligand Name | CL097 |
| Source | derivative of the imidazoquinoline compound R848(others) |
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | The binding induces the production of IL-6, IL-10, TNF-‚ç∫ and IL-23 |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Lamina propria DCs obtained from the human GI tract |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It induces intestinal inflammation and potentially alter the homeostatic response to commensal flora |
| Assay used | NA |
| PMID | 20483758 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0435 |
| Ligand Name | CL097 |
| Source | derivative of the imidazoquinoline compound R848(others) |
| Sequence of ligand | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | The binding induces the production of IL-6, IL-10, TNF-‚ç∫ and IL-23 |
| Name of receptor | Toll-like receptor 7/8 (TLR7/8) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Lamina propria DCs obtained from the human GI tract |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It induces intestinal inflammation and potentially alter the homeostatic response to commensal flora |
| Assay used | NA |
| PMID | 20483758 |
| Year of Publication | 2010 |
| Pubchem assay | NA |