| Primary information |
|---|
| PRRID | PRRID_0433 |
| Ligand Name | Chitin |
| Source | Crab shell(others) |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It induces phosphorylation of CERK1 at multiple residues in the juxtamembrane and kinase domain |
| Name of receptor | lysin motif (LysM)- containing chitin elicitor receptor kinase 1 (CERK1) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Arabidopsis |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | A8R7E6.fasta |
| Swiss prot ID | A8R7E6 |
| Length Of Receptor | 617 |
| Function | It provides resistance o fungal pathogens |
| Assay used | NA |
| PMID | 20610395 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0433 |
| Ligand Name | Chitin |
| Source | Crab shell(others) |
| Sequence of ligand | CC(=O)NC1C(C(C(OC1O)CO)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | It induces phosphorylation of CERK1 at multiple residues in the juxtamembrane and kinase domain |
| Name of receptor | lysin motif (LysM)- containing chitin elicitor receptor kinase 1 (CERK1) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Arabidopsis |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | A8R7E6.fasta |
| Swiss prot ID | A8R7E6 |
| Length Of Receptor | 617 |
| Function | It provides resistance o fungal pathogens |
| Assay used | NA |
| PMID | 20610395 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |