| Primary information |
|---|
| PRRID | PRRID_0413 |
| Ligand Name | ATP |
| Source | Injured cell (others) |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Natural |
| Role of Ligand | Activates Caspase-1, which results in the processing and release of the proinfl ammatory cytokines IL-1β and IL-18. |
| Name of receptor | P2 |
| Type of receptor | Purinergic Receptor |
| Source | Endogenous |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the inflammation of the cell |
| Assay used | NA |
| PMID | 20740341 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0413 |
| Ligand Name | ATP |
| Source | Injured cell (others) |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Natural |
| Role of Ligand | Activates Caspase-1, which results in the processing and release of the proinfl ammatory cytokines IL-1β and IL-18. |
| Name of receptor | P2 |
| Type of receptor | Purinergic Receptor |
| Source | Endogenous |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the inflammation of the cell |
| Assay used | NA |
| PMID | 20740341 |
| Year of Publication | 2010 |
| Pubchem assay | NA |