| Primary information |
|---|
| PRRID | PRRID_0409 |
| Ligand Name | Adenosine |
| Source | Injured cell (others) |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Mediate the effect through cAMP and resulted into release of proinflammatory cytokines |
| Name of receptor | A2 |
| Type of receptor | Purinergic Receptor |
| Source | Endogenous |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the inflammation of the cell |
| Assay used | NA |
| PMID | 20740341 |
| Year of Publication | 2010 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0409 |
| Ligand Name | Adenosine |
| Source | Injured cell (others) |
| Sequence of ligand | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)CO)O)O |
| Length | NA |
| Type | Damage-associated molecular patterns (DAMPs) |
| Occurence | Natural |
| Role of Ligand | Mediate the effect through cAMP and resulted into release of proinflammatory cytokines |
| Name of receptor | A2 |
| Type of receptor | Purinergic Receptor |
| Source | Endogenous |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the inflammation of the cell |
| Assay used | NA |
| PMID | 20740341 |
| Year of Publication | 2010 |
| Pubchem assay | NA |