| Primary information |
|---|
| PRRID | PRRID_0401 |
| Ligand Name | 1,3 beta glucan |
| Source | Sparassis crispa (fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Anti-tumour properties |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | dendritic cells and macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | It can induce the phenotypic and functional maturation of DCs. |
| Assay used | NA |
| PMID | 20699131 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0401 |
| Ligand Name | 1,3 beta glucan |
| Source | Sparassis crispa (fungi) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Natural |
| Role of Ligand | Anti-tumour properties |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | dendritic cells and macrophages |
| Domain | Leucine-rich Repeat (LRR) Domain |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | It can induce the phenotypic and functional maturation of DCs. |
| Assay used | NA |
| PMID | 20699131 |
| Year of Publication | 2010 |
| Pubchem assay | Pubchem Assay |