| Primary information |
|---|
| PRRID | PRRID_0377 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Poly (I:C) induces the generation of IRF3-dependent type I IFN and triggers the activation of the Rho GTPase RhoA, which leads to the activation of NF-kappaB. |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lung epithelial cells (small airway lung epithelial (SALE)) |
| Domain | NA |
| Sequence of Receptor | O15455.fasta |
| Swiss prot ID | O15455 |
| Length Of Receptor | 904 |
| Function | This induces the inflammatory response. |
| Assay used | NF-kappaB-luciferase reporter assays |
| PMID | 19265130 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0377 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Poly (I:C) induces the generation of IRF3-dependent type I IFN and triggers the activation of the Rho GTPase RhoA, which leads to the activation of NF-kappaB. |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lung epithelial cells (small airway lung epithelial (SALE)) |
| Domain | NA |
| Sequence of Receptor | O15455.fasta |
| Swiss prot ID | O15455 |
| Length Of Receptor | 904 |
| Function | This induces the inflammatory response. |
| Assay used | NF-kappaB-luciferase reporter assays |
| PMID | 19265130 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |