| Primary information |
|---|
| PRRID | PRRID_0375 |
| Ligand Name | MALP-2 (macrophage-activating lipopeptide 2) |
| Source | NA |
| Sequence of ligand | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Length | NA |
| Type | Lipopeptides |
| Occurence | Natural |
| Role of Ligand | MALP-2-induced degradation of I |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lung epithelial cells (small airway lung epithelial (SALE)) |
| Domain | NA |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | This induces the inflammatory response. |
| Assay used | NF-kappaB-luciferase reporter assays |
| PMID | 19265130 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0375 |
| Ligand Name | MALP-2 (macrophage-activating lipopeptide 2) |
| Source | NA |
| Sequence of ligand | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Length | NA |
| Type | Lipopeptides |
| Occurence | Natural |
| Role of Ligand | MALP-2-induced degradation of I |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | lung epithelial cells (small airway lung epithelial (SALE)) |
| Domain | NA |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | This induces the inflammatory response. |
| Assay used | NF-kappaB-luciferase reporter assays |
| PMID | 19265130 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |