| Primary information |
|---|
| PRRID | PRRID_0374 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | S. gordonii (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Stimulation elicits the production of tumour necrosis factor (TNF) and interleukin (IL)-6. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Bone-marrow derived Dendritic cells |
| Domain | LRR |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | This activation can be attributed to multiple immunostimulatory components present within S. gordonii bacterial cells. |
| Assay used | ELISA |
| PMID | 19284500 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0374 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | S. gordonii (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Stimulation elicits the production of tumour necrosis factor (TNF) and interleukin (IL)-6. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Bone-marrow derived Dendritic cells |
| Domain | LRR |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | This activation can be attributed to multiple immunostimulatory components present within S. gordonii bacterial cells. |
| Assay used | ELISA |
| PMID | 19284500 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |