| Primary information |
|---|
| PRRID | PRRID_0372 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | It induces the production of the pro-inflammatory cytokines such as TNF-alpha and CXCL8. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Dental pulp fibroblasts |
| Domain | LRR |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It has inflammatory/immune response agianst gram-positive bacteria. |
| Assay used | ELISA |
| PMID | 19250704 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0372 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | It induces the production of the pro-inflammatory cytokines such as TNF-alpha and CXCL8. |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Dental pulp fibroblasts |
| Domain | LRR |
| Sequence of Receptor | O60603.fasta |
| Swiss prot ID | O60603 |
| Length Of Receptor | 784 |
| Function | It has inflammatory/immune response agianst gram-positive bacteria. |
| Assay used | ELISA |
| PMID | 19250704 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |