| Primary information |
|---|
| PRRID | PRRID_0368 |
| Ligand Name | Hyaluronan |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | Hyaluronan works through IL-1beta and the cryopyrin system to signal sterile inflammation. |
| Name of receptor | Nod-like receptor protein P3/Cryopyrin (NLRP3/Cryopyrin) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | Macropahges |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | It participates in the inflammatory response to injury or the cytokine response to hyaluronan. |
| Assay used | ELISA |
| PMID | 19258328 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0368 |
| Ligand Name | Hyaluronan |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | Hyaluronan works through IL-1beta and the cryopyrin system to signal sterile inflammation. |
| Name of receptor | Nod-like receptor protein P3/Cryopyrin (NLRP3/Cryopyrin) |
| Type of receptor | NOD-like receptor (NLR) |
| Source | Mice |
| Localization | Macropahges |
| Domain | NA |
| Sequence of Receptor | Q8BHB0.fasta |
| Swiss prot ID | Q8BHB0 |
| Length Of Receptor | 953 |
| Function | It participates in the inflammatory response to injury or the cytokine response to hyaluronan. |
| Assay used | ELISA |
| PMID | 19258328 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |