| Primary information |
|---|
| PRRID | PRRID_0366 |
| Ligand Name | Dextran Sulfate Sodium (DSS) |
| Source | Dietary Products(others) |
| Sequence of ligand | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)O.Na |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Synthetic |
| Role of Ligand | It has the its inhibitory effects on LPS-induced TLR4-mediated NF-kappaB activation. |
| Name of receptor | Deleted in malignant brain tumors 1 (DMBT1) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q60997.fasta |
| Swiss prot ID | Q60997 |
| Length Of Receptor | 2085 |
| Function | DSS inhibit DMBT1-mediated bacterial aggregation. |
| Assay used | ELISA |
| PMID | 19189310 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0366 |
| Ligand Name | Dextran Sulfate Sodium (DSS) |
| Source | Dietary Products(others) |
| Sequence of ligand | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)OS(=O)(=O)O)O.Na |
| Length | NA |
| Type | Carbohydrate |
| Occurence | Synthetic |
| Role of Ligand | It has the its inhibitory effects on LPS-induced TLR4-mediated NF-kappaB activation. |
| Name of receptor | Deleted in malignant brain tumors 1 (DMBT1) |
| Type of receptor | Pattern recognition receptor (PRR) |
| Source | Mice |
| Localization | NA |
| Domain | NA |
| Sequence of Receptor | Q60997.fasta |
| Swiss prot ID | Q60997 |
| Length Of Receptor | 2085 |
| Function | DSS inhibit DMBT1-mediated bacterial aggregation. |
| Assay used | ELISA |
| PMID | 19189310 |
| Year of Publication | 2009 |
| Pubchem assay | Pubchem Assay |