| Primary information |
|---|
| PRRID | PRRID_0355 |
| Ligand Name | β- 1,3-glucan |
| Source | Gram negative Bacteria (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | AgGNBPA1 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Anopheles gambiae |
| Localization | salivary gland and thorax |
| Domain | β-1,3-glucan binding domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | in vitro bacterial binding assay |
| PMID | 18237283 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0355 |
| Ligand Name | β- 1,3-glucan |
| Source | Gram negative Bacteria (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
| Length | NA |
| Type | NA |
| Occurence | Natural |
| Role of Ligand | NA |
| Name of receptor | AgGNBPA1 |
| Type of receptor | Gram-negative Bacteria-binding Protein (GNBPs) |
| Source | Anopheles gambiae |
| Localization | salivary gland and thorax |
| Domain | β-1,3-glucan binding domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | NA |
| Assay used | in vitro bacterial binding assay |
| PMID | 18237283 |
| Year of Publication | 2008 |
| Pubchem assay | NA |