| Primary information |
|---|
| PRRID | PRRID_0340 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Stilmulation leads to the activation of the IRF3. |
| Name of receptor | RIG-1 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | Human |
| Localization | Primary Human Keratinocytes |
| Domain | NA |
| Sequence of Receptor | O95786.fasta |
| Swiss prot ID | O95786 |
| Length Of Receptor | 925 |
| Function | It is responsible for the antiviral defense status. |
| Assay used | ELISA |
| PMID | 18684960 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0340 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | Stilmulation leads to the activation of the IRF3. |
| Name of receptor | RIG-1 |
| Type of receptor | Rig-like receptor (RLR) |
| Source | Human |
| Localization | Primary Human Keratinocytes |
| Domain | NA |
| Sequence of Receptor | O95786.fasta |
| Swiss prot ID | O95786 |
| Length Of Receptor | 925 |
| Function | It is responsible for the antiviral defense status. |
| Assay used | ELISA |
| PMID | 18684960 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |