| Primary information |
|---|
| PRRID | PRRID_0337 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It leads to up-regulation of the genes interferon (IFN)-alpha1/alpha2, Mx, CXCL10, IL-1beta, IFN-gamma and CD83. |
| Name of receptor | Toll-like receptor 9 (TLR9) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Salmo salar L. |
| Localization | Spleen and head kidney |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It resulted into viral recognition, resulting in an enhanced innate immune response. |
| Assay used | NA |
| PMID | 18602433 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0337 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | It leads to up-regulation of the genes interferon (IFN)-alpha1/alpha2, Mx, CXCL10, IL-1beta, IFN-gamma and CD83. |
| Name of receptor | Toll-like receptor 9 (TLR9) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Salmo salar L. |
| Localization | Spleen and head kidney |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It resulted into viral recognition, resulting in an enhanced innate immune response. |
| Assay used | NA |
| PMID | 18602433 |
| Year of Publication | 2008 |
| Pubchem assay | NA |