| Primary information |
|---|
| PRRID | PRRID_0336 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | They produce the proinflammatory molecule ICAM1 and secrete functionally active CCL2 chemokine. |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Sertoli cells |
| Domain | LRR |
| Sequence of Receptor | Q99MB1.fasta |
| Swiss prot ID | Q99MB1 |
| Length Of Receptor | 905 |
| Function | Poly (I:C) elicits both inflammatory and antiviral responses in Sertoli cells. |
| Assay used | ELISA |
| PMID | 18596219 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0336 |
| Ligand Name | polyinosinic-polycytidylic acid [poly(I:C)] |
| Source | NA |
| Sequence of ligand | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | They produce the proinflammatory molecule ICAM1 and secrete functionally active CCL2 chemokine. |
| Name of receptor | Toll-like receptor 3 (TLR3) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice |
| Localization | Sertoli cells |
| Domain | LRR |
| Sequence of Receptor | Q99MB1.fasta |
| Swiss prot ID | Q99MB1 |
| Length Of Receptor | 905 |
| Function | Poly (I:C) elicits both inflammatory and antiviral responses in Sertoli cells. |
| Assay used | ELISA |
| PMID | 18596219 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |