| Primary information |
|---|
| PRRID | PRRID_0331 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | It leads to the increased p38 MAPK activity and produce antimicrobial peptide β-defensin-2 (mBD-2). |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Pleural mesothelial cells |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | PGN-activated PMC-derived mBD-2 significantly killed Staphylococcus aureus. |
| Assay used | Antimicrobial assay |
| PMID | 18621910 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0331 |
| Ligand Name | Peptidoglycan (PGN) |
| Source | S. aureus (Bacteria) |
| Sequence of ligand | CC(C(=O)O)OC1C(C(OC(C1O)CO)O)N |
| Length | NA |
| Type | Peptidoglycan |
| Occurence | Natural |
| Role of Ligand | It leads to the increased p38 MAPK activity and produce antimicrobial peptide β-defensin-2 (mBD-2). |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Pleural mesothelial cells |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | PGN-activated PMC-derived mBD-2 significantly killed Staphylococcus aureus. |
| Assay used | Antimicrobial assay |
| PMID | 18621910 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |