| Primary information |
|---|
| PRRID | PRRID_0327 |
| Ligand Name | MG149 |
| Source | Mycoplasma genitalium (Bacteria) |
| Sequence of ligand | CCCCCCCC1=CC=C(C=C1)CCC2=C(C(=CC=C2)O)C(=O)O |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | On binding to the TLR2, it induces the activation of NF- |
| Name of receptor | Toll-like receptor (TLR1 and Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Kidney cell line, 293T |
| Domain | LRR |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has a immunostimulatory role |
| Assay used | ELISA |
| PMID | 18474641 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0327 |
| Ligand Name | MG149 |
| Source | Mycoplasma genitalium (Bacteria) |
| Sequence of ligand | CCCCCCCC1=CC=C(C=C1)CCC2=C(C(=CC=C2)O)C(=O)O |
| Length | NA |
| Type | Lipoprotein |
| Occurence | Natural |
| Role of Ligand | On binding to the TLR2, it induces the activation of NF- |
| Name of receptor | Toll-like receptor (TLR1 and Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Kidney cell line, 293T |
| Domain | LRR |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It has a immunostimulatory role |
| Assay used | ELISA |
| PMID | 18474641 |
| Year of Publication | 2008 |
| Pubchem assay | NA |