| Primary information |
|---|
| PRRID | PRRID_0323 |
| Ligand Name | Low Molecular Weight Hyaluronic Acid (LMW-HA) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | It leads to the production of antimicrobial peptide beta defensins 2. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Dorsal skin |
| Domain | NA |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | It leadsto the induction of an antibacterial response. |
| Assay used | ELISA |
| PMID | 18641349 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0323 |
| Ligand Name | Low Molecular Weight Hyaluronic Acid (LMW-HA) |
| Source | Host (Endogenous) (others) |
| Sequence of ligand | CC(=O)NC1CC(C(OC1OC2C(C(C(OC2C(=O)[O-])O)O)O)CO)O |
| Length | NA |
| Type | Glycosaminoglycan |
| Occurence | Natural |
| Role of Ligand | It leads to the production of antimicrobial peptide beta defensins 2. |
| Name of receptor | Toll-like receptor 4 (TLR4) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | Dorsal skin |
| Domain | NA |
| Sequence of Receptor | Q9QUK6.fasta |
| Swiss prot ID | Q9QUK6 |
| Length Of Receptor | 835 |
| Function | It leadsto the induction of an antibacterial response. |
| Assay used | ELISA |
| PMID | 18641349 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |