| Primary information |
|---|
| PRRID | PRRID_0318 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Enterococcus faecalis (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Upon exposure to E. faecalis LTA, it produces a high level of tumor necrosis factor-‚ç∫ (TNF-‚ç∫) and nitric oxide (NO). |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | RAW 264.7 |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | LTA contributes to E. faecalis–induced inflammatory responses. |
| Assay used | ELISA |
| PMID | 18634930 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0318 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Enterococcus faecalis (Bacteria) |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | Upon exposure to E. faecalis LTA, it produces a high level of tumor necrosis factor-‚ç∫ (TNF-‚ç∫) and nitric oxide (NO). |
| Name of receptor | Toll-like receptor 2 (TLR2) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Mice (Murine) |
| Localization | RAW 264.7 |
| Domain | NA |
| Sequence of Receptor | Q9QUN7.fasta |
| Swiss prot ID | Q9QUN7 |
| Length Of Receptor | 784 |
| Function | LTA contributes to E. faecalis–induced inflammatory responses. |
| Assay used | ELISA |
| PMID | 18634930 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |