| Primary information |
|---|
| PRRID | PRRID_0317 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | BbFREP can specifically bind LTA. |
| Name of receptor | BbFREP |
| Type of receptor | Multivalent Pattern recognition receptor (PRR) |
| Source | Amphioxus (Branchiostoma belcheri) |
| Localization | hepatic caecum |
| Domain | fibrinogen-like (FBG) domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the bacteriolytic activity via interaction with LTA. |
| Assay used | ELISA |
| PMID | 18533266 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0317 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | BbFREP can specifically bind LTA. |
| Name of receptor | BbFREP |
| Type of receptor | Multivalent Pattern recognition receptor (PRR) |
| Source | Amphioxus (Branchiostoma belcheri) |
| Localization | hepatic caecum |
| Domain | fibrinogen-like (FBG) domain |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | It leads to the bacteriolytic activity via interaction with LTA. |
| Assay used | ELISA |
| PMID | 18533266 |
| Year of Publication | 2008 |
| Pubchem assay | NA |