| Primary information |
|---|
| PRRID | PRRID_0315 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | LTA binds to vitellogenin with high affinity. |
| Name of receptor | Vitellogenin |
| Type of receptor | Phospholipoglycoprotein |
| Source | Hexagrammos otakii |
| Localization | Macropahes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Vg is involved in anti-infectious response, functions as an opsonin that can enhance macrophage phagocytosis. |
| Assay used | ELISA |
| PMID | 18398466 |
| Year of Publication | 2008 |
| Pubchem assay | NA |
| Primary information |
|---|
| PRRID | PRRID_0315 |
| Ligand Name | Lipoteichoic Acid (LTA) |
| Source | Gram-positive bacteria |
| Sequence of ligand | C(C1C(C(C(C(O1)OCC(CO)O)OC2C(C(C(C(O2)COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(COP(=O)(O)OCC(CO)O)O)O)O)O)O)O)O)O)O |
| Length | NA |
| Type | Amphiphile |
| Occurence | Natural |
| Role of Ligand | LTA binds to vitellogenin with high affinity. |
| Name of receptor | Vitellogenin |
| Type of receptor | Phospholipoglycoprotein |
| Source | Hexagrammos otakii |
| Localization | Macropahes |
| Domain | NA |
| Sequence of Receptor | NA |
| Swiss prot ID | NA |
| Length Of Receptor | NA |
| Function | Vg is involved in anti-infectious response, functions as an opsonin that can enhance macrophage phagocytosis. |
| Assay used | ELISA |
| PMID | 18398466 |
| Year of Publication | 2008 |
| Pubchem assay | NA |