| Primary information |
|---|
| PRRID | PRRID_0298 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | imiquimod leads to decreased tyrosinase and MITF expression and is accompanied by decreased pigmentation. |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Melanocytes |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | It inhibits Melanogenesis and Proliferation of Human Melanocytes. |
| Assay used | NA |
| PMID | 18596825 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |
| Primary information |
|---|
| PRRID | PRRID_0298 |
| Ligand Name | Imiquimod |
| Source | NA |
| Sequence of ligand | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Length | NA |
| Type | Nucleic Acid |
| Occurence | Synthetic |
| Role of Ligand | imiquimod leads to decreased tyrosinase and MITF expression and is accompanied by decreased pigmentation. |
| Name of receptor | Toll-like receptor 7 (TLR7) |
| Type of receptor | Toll-like receptor (TLR) |
| Source | Human |
| Localization | Melanocytes |
| Domain | NA |
| Sequence of Receptor | Q9NYK1.fasta |
| Swiss prot ID | Q9NYK1 |
| Length Of Receptor | 1049 |
| Function | It inhibits Melanogenesis and Proliferation of Human Melanocytes. |
| Assay used | NA |
| PMID | 18596825 |
| Year of Publication | 2008 |
| Pubchem assay | Pubchem Assay |